CAS 1219945-14-8 is the registry number for tert-Butyl 3-(cyanomethyl)-6-fluoro-1H-indole-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 3-(cyanomethyl)-6-fluoroindole-1-carboxylate (CAS 1219945-14-8) is a chemical compound with the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. IUPAC name: tert-butyl 3-(cyanomethyl)-6-fluoroindole-1-carboxylate. InChIKey: IGEXLMJUNKYYSO-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O2 |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | tert-butyl 3-(cyanomethyl)-6-fluoroindole-1-carboxylate |
| InChIKey | IGEXLMJUNKYYSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)F)CC#N |
Computed by PubChem (NCBI)