Products 355816-87-4
CAS 355816-87-4 is the registry number for 2-(4-Fluorophenyl)-N-(2-Nitrobenzyl)Ethanamine. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
2-(4-fluorophenyl)-N-[(2-nitrophenyl)methyl]ethanamine (CAS 355816-87-4) is a chemical compound with the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. IUPAC name: 2-(4-fluorophenyl)-N-[(2-nitrophenyl)methyl]ethanamine. InChIKey: HNVPRVIQHQQGAK-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O2 |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-N-[(2-nitrophenyl)methyl]ethanamine |
| InChIKey | HNVPRVIQHQQGAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNCCC2=CC=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)