CAS 923846-56-4 is the registry number for 1-(4-Fluorophenyl)-1H,4H,5H,6H,7H,8H-cyclohepta(c)pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxylic acid (CAS 923846-56-4) is a chemical compound with the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. IUPAC name: 1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxylic acid. InChIKey: PLMBWLDNELWLAJ-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O2 |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxylic acid |
| InChIKey | PLMBWLDNELWLAJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)N(N=C2C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)