Products 355383-13-0
CAS 355383-13-0 is the registry number for 2-(4-Fluorophenyl)-N-(4-Nitrobenzyl)Ethanamine. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg.
2-(4-fluorophenyl)-N-[(4-nitrophenyl)methyl]ethanamine (CAS 355383-13-0) is a chemical compound with the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. IUPAC name: 2-(4-fluorophenyl)-N-[(4-nitrophenyl)methyl]ethanamine. InChIKey: YPXJMSHPWWJFJB-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O2 |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-N-[(4-nitrophenyl)methyl]ethanamine |
| InChIKey | YPXJMSHPWWJFJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNCC2=CC=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)