Products 912784-67-9
CAS 912784-67-9 appears in our catalog under these names: WAY–328127, WAY-328127, 98.0%, N-Cyclopentyl-5-(4-fluorophenyl)isoxazole-3-carboxamide, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg, 25mg, 50mg, 100mg, 250mg.
N-cyclopentyl-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide (CAS 912784-67-9) is a chemical compound with the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. IUPAC name: N-cyclopentyl-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide. InChIKey: CXPGIBUNOFAQOI-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O2 |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | N-cyclopentyl-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide |
| InChIKey | CXPGIBUNOFAQOI-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=NOC(=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)