CAS 926195-95-1 is the registry number for 1-(3-Fluoro-4-methylphenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3-fluoro-4-methylphenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CAS 926195-95-1) is a chemical compound with the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. IUPAC name: 1-(3-fluoro-4-methylphenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid. InChIKey: KQCAUOYAAHUCJZ-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O2 |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | 1-(3-fluoro-4-methylphenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| InChIKey | KQCAUOYAAHUCJZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C3=C(CCCC3)C(=N2)C(=O)O)F |
Computed by PubChem (NCBI)