Products 1220422-10-5
CAS 1220422-10-5 appears in our catalog under these names: 5-Bromo-2-(methylthio)nicotinic acid, 97%, 5-Bromo-2-(methylsulfanyl)pyridine-3-carboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-bromo-2-methylsulfanylpyridine-3-carboxylic acid (CAS 1220422-10-5) is a chemical compound with the molecular formula C7H6BrNO2S and a molecular weight of 248.10 g/mol. IUPAC name: 5-bromo-2-methylsulfanylpyridine-3-carboxylic acid. InChIKey: JQTCTMUKQWAJNV-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2S |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 5-bromo-2-methylsulfanylpyridine-3-carboxylic acid |
| InChIKey | JQTCTMUKQWAJNV-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=N1)Br)C(=O)O |
Computed by PubChem (NCBI)