CAS 1694180-93-2 appears in our catalog under these names: 2-Bromo-5-cyclopropyl-1,3-thiazole-4-carboxylic acid, 95%, 2-Bromo-5-cyclopropyl-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-bromo-5-cyclopropyl-1,3-thiazole-4-carboxylic acid (CAS 1694180-93-2) is a chemical compound with the molecular formula C7H6BrNO2S and a molecular weight of 248.10 g/mol. IUPAC name: 2-bromo-5-cyclopropyl-1,3-thiazole-4-carboxylic acid. InChIKey: RTRDSWYJZRWTQI-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2S |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-bromo-5-cyclopropyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | RTRDSWYJZRWTQI-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(N=C(S2)Br)C(=O)O |
Computed by PubChem (NCBI)