CAS 68257-90-9 is the registry number for 5-(2-Bromoacetyl)thiophene-2-carboxamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-bromoacetyl)thiophene-2-carboxamide (CAS 68257-90-9) is a chemical compound with the molecular formula C7H6BrNO2S and a molecular weight of 248.10 g/mol. IUPAC name: 5-(2-bromoacetyl)thiophene-2-carboxamide. InChIKey: UEIAQIIRSAGLJM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2S |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 5-(2-bromoacetyl)thiophene-2-carboxamide |
| InChIKey | UEIAQIIRSAGLJM-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C(=O)N)C(=O)CBr |
Computed by PubChem (NCBI)