CAS 2786829-47-6 is the registry number for Methyl (E)-3-(2-bromothiazol-4-yl)acrylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoate (CAS 2786829-47-6) is a chemical compound with the molecular formula C7H6BrNO2S and a molecular weight of 248.10 g/mol. IUPAC name: methyl (E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoate. InChIKey: WMCRFSMHPXFQLP-NSCUHMNNSA-N.
| Molecular formula | C7H6BrNO2S |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | methyl (E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoate |
| InChIKey | WMCRFSMHPXFQLP-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=CSC(=N1)Br |
Computed by PubChem (NCBI)