Products 2794196-73-7

CAS 2794196-73-7 is the registry number for 2-Bromo-3-(methylthio)isonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromo-3-methylsulfanylpyridine-4-carboxylic acid (CAS 2794196-73-7) is a chemical compound with the molecular formula C7H6BrNO2S and a molecular weight of 248.10 g/mol. IUPAC name: 2-bromo-3-methylsulfanylpyridine-4-carboxylic acid. InChIKey: LAFKRGCEEDSPKB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrNO2S
Molecular weight248.10 g/mol
IUPAC name2-bromo-3-methylsulfanylpyridine-4-carboxylic acid
InChIKeyLAFKRGCEEDSPKB-UHFFFAOYSA-N
SMILESCSC1=C(C=CN=C1Br)C(=O)O

Computed by PubChem (NCBI)