Products 175205-19-3
CAS 175205-19-3 is the registry number for 4-Bromo-2-(2-nitroprop-1-enyl)thiophene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-(2-nitroprop-1-enyl)thiophene (CAS 175205-19-3) is a chemical compound with the molecular formula C7H6BrNO2S and a molecular weight of 248.10 g/mol. IUPAC name: 4-bromo-2-(2-nitroprop-1-enyl)thiophene. InChIKey: DEFWRSIMNNRSKK-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2S |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 4-bromo-2-(2-nitroprop-1-enyl)thiophene |
| InChIKey | DEFWRSIMNNRSKK-UHFFFAOYSA-N |
| SMILES | CC(=CC1=CC(=CS1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)