CAS 1220993-44-1 appears in our catalog under these names: Ivabradine Impurity 40, (S)-3,4-Dimethoxybicyclo(4.2.0)octa-1,3,5-triene-7-carboxylic acid, 98%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 5g.
(7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid (CAS 1220993-44-1) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid. InChIKey: IHPWCJZOCLQJPX-QMMMGPOBSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid |
| InChIKey | IHPWCJZOCLQJPX-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C2[C@H](CC2=C1)C(=O)O)OC |
Computed by PubChem (NCBI)