CAS 41234-23-5 appears in our catalog under these names: 3,4-Dimethoxybicyclo(4.2.0)octa-1,3,5-triene-7-carboxylic acid, 98%, 3,4-Dimethoxybicyclo[4.2.0]Octa-1,3,5-triene-7-carboxylic acid, 98%, 98%, 3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid (CAS 41234-23-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid. InChIKey: IHPWCJZOCLQJPX-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid |
| InChIKey | IHPWCJZOCLQJPX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(CC2=C1)C(=O)O)OC |
Computed by PubChem (NCBI)