Products 1221239-14-0
CAS 1221239-14-0 is the registry number for 1,2-Dihydrocyclopenta[c]carbazol-3(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dihydro-1H-cyclopenta[c]carbazol-3-one (CAS 1221239-14-0) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 2,6-dihydro-1H-cyclopenta[c]carbazol-3-one. InChIKey: ZTXUVVLEYYDPSR-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2,6-dihydro-1H-cyclopenta[c]carbazol-3-one |
| InChIKey | ZTXUVVLEYYDPSR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C3=C(C=C2)NC4=CC=CC=C43 |
Computed by PubChem (NCBI)