CAS 1221724-56-6 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(3-(2-methyl-1,3-thiazol-4-yl)phenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(3-(2-methyl-1,3-thiazol-4-yl)phenyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,2,2-trifluoroethyl N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate (CAS 1221724-56-6) is a chemical compound with the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate. InChIKey: WSCYFHSUUHNBFI-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate |
| InChIKey | WSCYFHSUUHNBFI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)