CAS 327093-05-0 appears in our catalog under these names: 3-Amino-n-(3-trifluoromethyl-phenyl)-benzenesulfonamide, 95%, 3-Amino-N-(3-(trifluoromethyl)phenyl)benzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
3-amino-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (CAS 327093-05-0) is a chemical compound with the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. IUPAC name: 3-amino-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide. InChIKey: LNRXTKNBQCSDLR-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 3-amino-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| InChIKey | LNRXTKNBQCSDLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)