Products 2381044-82-0
CAS 2381044-82-0 is the registry number for 5-Mercapto-2-(4-methoxybenzyl)-4-(trifluoromethyl)pyridazin-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-methoxyphenyl)methyl]-5-sulfanyl-4-(trifluoromethyl)pyridazin-3-one (CAS 2381044-82-0) is a chemical compound with the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl]-5-sulfanyl-4-(trifluoromethyl)pyridazin-3-one. InChIKey: GSSWSXMBQHZFHU-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methyl]-5-sulfanyl-4-(trifluoromethyl)pyridazin-3-one |
| InChIKey | GSSWSXMBQHZFHU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)C(=C(C=N2)S)C(F)(F)F |
Computed by PubChem (NCBI)