Products 175277-54-0
CAS 175277-54-0 is the registry number for Ethyl 4-methyl-2-(5-(trifluoromethyl)pyridin-2-yl)thiazole-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxylate (CAS 175277-54-0) is a chemical compound with the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. IUPAC name: ethyl 4-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxylate. InChIKey: AWWOISQGZUJOIW-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | ethyl 4-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxylate |
| InChIKey | AWWOISQGZUJOIW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=NC=C(C=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)