Products 832739-60-3
CAS 832739-60-3 is the registry number for 2-(Ethylsulfonyl)-4-phenyl-6-(trifluoromethyl)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-ethylsulfonyl-4-phenyl-6-(trifluoromethyl)pyrimidine (CAS 832739-60-3) is a chemical compound with the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. IUPAC name: 2-ethylsulfonyl-4-phenyl-6-(trifluoromethyl)pyrimidine. InChIKey: QXVPOGYCXMJHRE-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 2-ethylsulfonyl-4-phenyl-6-(trifluoromethyl)pyrimidine |
| InChIKey | QXVPOGYCXMJHRE-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=NC(=CC(=N1)C(F)(F)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)