Products 497083-29-1
CAS 497083-29-1 is the registry number for 1-(5-methyl-3-((4-(trifluoromethoxy)phenyl)amino)-2,4-thiazolyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-[4-methyl-2-[4-(trifluoromethoxy)anilino]-1,3-thiazol-5-yl]ethanone (CAS 497083-29-1) is a chemical compound with the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. IUPAC name: 1-[4-methyl-2-[4-(trifluoromethoxy)anilino]-1,3-thiazol-5-yl]ethanone. InChIKey: HLIGIEZEFARWPW-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 1-[4-methyl-2-[4-(trifluoromethoxy)anilino]-1,3-thiazol-5-yl]ethanone |
| InChIKey | HLIGIEZEFARWPW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=CC=C(C=C2)OC(F)(F)F)C(=O)C |
Computed by PubChem (NCBI)