Products 122243-30-5
CAS 122243-30-5 appears in our catalog under these names: 2-(3-Bromophenyl)-1,1,1-trifluoropropan-2-ol, 2-(3-Bromophenyl)-1,1,1-trifluoropropan-2-ol, 95%, 95%, 2-(3-Bromophenyl)-1,1,1-trifluoropropan-2-ol, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 500mg, 2.5g, 5g.
2-(3-bromophenyl)-1,1,1-trifluoropropan-2-ol (CAS 122243-30-5) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 2-(3-bromophenyl)-1,1,1-trifluoropropan-2-ol. InChIKey: NSFHTONABRSTTQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | NSFHTONABRSTTQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)Br)(C(F)(F)F)O |
Computed by PubChem (NCBI)