CAS 122263-78-9 appears in our catalog under these names: 4-Fluoro-3,5-dimethylbenzene-1-sulfonyl chloride, 95%, 4-Fluoro-3,5-dimethylbenzene-1-sulfonyl chloride 95%, 4-Fluoro-3,5-dimethylbenzene-1-sulfonyl chloride, 95%, 95%, 4-Fluoro-3,5-dimethylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
4-fluoro-3,5-dimethylbenzenesulfonyl chloride (CAS 122263-78-9) is a chemical compound with the molecular formula C8H8ClFO2S and a molecular weight of 222.66 g/mol. IUPAC name: 4-fluoro-3,5-dimethylbenzenesulfonyl chloride. InChIKey: YHSLPTNUIVEZSI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO2S |
|---|---|
| Molecular weight | 222.66 g/mol |
| IUPAC name | 4-fluoro-3,5-dimethylbenzenesulfonyl chloride |
| InChIKey | YHSLPTNUIVEZSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)