Products 1785148-10-8

CAS 1785148-10-8 is the registry number for 3-Fluoro-2,4-dimethylbenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-fluoro-2,4-dimethylbenzenesulfonyl chloride (CAS 1785148-10-8) is a chemical compound with the molecular formula C8H8ClFO2S and a molecular weight of 222.66 g/mol. IUPAC name: 3-fluoro-2,4-dimethylbenzenesulfonyl chloride. InChIKey: HFAFJCREOJDUDV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO2S
Molecular weight222.66 g/mol
IUPAC name3-fluoro-2,4-dimethylbenzenesulfonyl chloride
InChIKeyHFAFJCREOJDUDV-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)S(=O)(=O)Cl)C)F

Computed by PubChem (NCBI)