CAS 1694456-19-3 appears in our catalog under these names: 2-Fluoro-4,6-dimethylbenzenesulfonyl chloride, 98%, 2-Fluoro-4,6-dimethylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
2-fluoro-4,6-dimethylbenzenesulfonyl chloride (CAS 1694456-19-3) is a chemical compound with the molecular formula C8H8ClFO2S and a molecular weight of 222.66 g/mol. IUPAC name: 2-fluoro-4,6-dimethylbenzenesulfonyl chloride. InChIKey: ODNOAFDLSULRQD-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO2S |
|---|---|
| Molecular weight | 222.66 g/mol |
| IUPAC name | 2-fluoro-4,6-dimethylbenzenesulfonyl chloride |
| InChIKey | ODNOAFDLSULRQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)