CAS 88972-03-6 is the registry number for 4-Fluoro-2,6-dimethylbenzene-1-sulfonyl chloride 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-fluoro-2,6-dimethylbenzenesulfonyl chloride (CAS 88972-03-6) is a chemical compound with the molecular formula C8H8ClFO2S and a molecular weight of 222.66 g/mol. IUPAC name: 4-fluoro-2,6-dimethylbenzenesulfonyl chloride. InChIKey: RVCGNZNOJBRAGG-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO2S |
|---|---|
| Molecular weight | 222.66 g/mol |
| IUPAC name | 4-fluoro-2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | RVCGNZNOJBRAGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)C)F |
Computed by PubChem (NCBI)