CAS 1505607-08-8 is the registry number for (2-Fluoro-4-methylphenyl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-fluoro-4-methylphenyl)methanesulfonyl chloride (CAS 1505607-08-8) is a chemical compound with the molecular formula C8H8ClFO2S and a molecular weight of 222.66 g/mol. IUPAC name: (2-fluoro-4-methylphenyl)methanesulfonyl chloride. InChIKey: GHJJQQQLLHPEEZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO2S |
|---|---|
| Molecular weight | 222.66 g/mol |
| IUPAC name | (2-fluoro-4-methylphenyl)methanesulfonyl chloride |
| InChIKey | GHJJQQQLLHPEEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)