CAS 25195-55-5 is the registry number for 4-Chloro-2-fluorobenzylmethylsulfone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
4-chloro-2-fluoro-1-(methylsulfonylmethyl)benzene (CAS 25195-55-5) is a chemical compound with the molecular formula C8H8ClFO2S and a molecular weight of 222.66 g/mol. IUPAC name: 4-chloro-2-fluoro-1-(methylsulfonylmethyl)benzene. InChIKey: VPLQKEAAUMOTPK-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO2S |
|---|---|
| Molecular weight | 222.66 g/mol |
| IUPAC name | 4-chloro-2-fluoro-1-(methylsulfonylmethyl)benzene |
| InChIKey | VPLQKEAAUMOTPK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)