Products 1223164-03-1
CAS 1223164-03-1 is the registry number for 3-Chloro-4-cyano-N,N-diethylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-cyano-N,N-diethylbenzenesulfonamide (CAS 1223164-03-1) is a chemical compound with the molecular formula C11H13ClN2O2S and a molecular weight of 272.75 g/mol. IUPAC name: 3-chloro-4-cyano-N,N-diethylbenzenesulfonamide. InChIKey: QURUDENAFHXNRR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2S |
|---|---|
| Molecular weight | 272.75 g/mol |
| IUPAC name | 3-chloro-4-cyano-N,N-diethylbenzenesulfonamide |
| InChIKey | QURUDENAFHXNRR-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)