Products 2701349-29-1
CAS 2701349-29-1 appears in our catalog under these names: nor–W–18–d4, Nor-W-18-d4. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
4-chloro-2,3,5,6-tetradeuterio-N-(2,3,4,5-tetrahydropyridin-6-yl)benzenesulfonamide (CAS 2701349-29-1) is a chemical compound with the molecular formula C11H13ClN2O2S and a molecular weight of 276.78 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetradeuterio-N-(2,3,4,5-tetrahydropyridin-6-yl)benzenesulfonamide. InChIKey: KYZKDMGAXVMSQY-UGWFXTGHSA-N.
| Molecular formula | C11H13ClN2O2S |
|---|---|
| Molecular weight | 276.78 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetradeuterio-N-(2,3,4,5-tetrahydropyridin-6-yl)benzenesulfonamide |
| InChIKey | KYZKDMGAXVMSQY-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1S(=O)(=O)NC2=NCCCC2)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)