CAS 20886-87-7 is the registry number for 2-(2-Chloro-acetylamino)-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid amide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (CAS 20886-87-7) is a chemical compound with the molecular formula C11H13ClN2O2S and a molecular weight of 272.75 g/mol. IUPAC name: 2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide. InChIKey: XRKRPMKJSPGFRD-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2S |
|---|---|
| Molecular weight | 272.75 g/mol |
| IUPAC name | 2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| InChIKey | XRKRPMKJSPGFRD-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)CCl)C(=O)N |
Computed by PubChem (NCBI)