CAS 796106-52-0 is the registry number for N'-(2-Chloroacetyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N'-(2-chloroacetyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (CAS 796106-52-0) is a chemical compound with the molecular formula C11H13ClN2O2S and a molecular weight of 272.75 g/mol. IUPAC name: N'-(2-chloroacetyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide. InChIKey: XZURWSYIMFOIRG-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2S |
|---|---|
| Molecular weight | 272.75 g/mol |
| IUPAC name | N'-(2-chloroacetyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| InChIKey | XZURWSYIMFOIRG-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(S2)C(=O)NNC(=O)CCl |
Computed by PubChem (NCBI)