CAS 2705469-55-0 is the registry number for nor–W–18. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
4-chloro-N-(2,3,4,5-tetrahydropyridin-6-yl)benzenesulfonamide (CAS 2705469-55-0) is a chemical compound with the molecular formula C11H13ClN2O2S and a molecular weight of 272.75 g/mol. IUPAC name: 4-chloro-N-(2,3,4,5-tetrahydropyridin-6-yl)benzenesulfonamide. InChIKey: KYZKDMGAXVMSQY-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2S |
|---|---|
| Molecular weight | 272.75 g/mol |
| IUPAC name | 4-chloro-N-(2,3,4,5-tetrahydropyridin-6-yl)benzenesulfonamide |
| InChIKey | KYZKDMGAXVMSQY-UHFFFAOYSA-N |
| SMILES | C1CCN=C(C1)NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)