CAS 1333524-10-9 appears in our catalog under these names: 1-{thieno(3,2-b)furan-5-carbonyl}piperazine hydrochloride, 98%, 1-{Thieno(3,2-b)furan-5-carbonyl}piperazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Piperazin-1-yl(thieno[3,2-b]furan-5-yl)methanone;hydrochloride (CAS 1333524-10-9) is a chemical compound with the molecular formula C11H13ClN2O2S and a molecular weight of 272.75 g/mol. IUPAC name: piperazin-1-yl(thieno[3,2-b]furan-5-yl)methanone;hydrochloride. InChIKey: GCQYJEWPLCGERM-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2S |
|---|---|
| Molecular weight | 272.75 g/mol |
| IUPAC name | piperazin-1-yl(thieno[3,2-b]furan-5-yl)methanone;hydrochloride |
| InChIKey | GCQYJEWPLCGERM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC3=C(S2)C=CO3.Cl |
Computed by PubChem (NCBI)