Products 1223568-82-8
CAS 1223568-82-8 is the registry number for GNX-865, 98.09%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 50 mg, 100 mg, 10 mg.
(E)-N-(3-chlorophenyl)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enamide (CAS 1223568-82-8) is a chemical compound with the molecular formula C16H14ClNO3 and a molecular weight of 303.74 g/mol. IUPAC name: (E)-N-(3-chlorophenyl)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enamide. InChIKey: UBNJOSSBOHRSMZ-SOFGYWHQSA-N.
| Molecular formula | C16H14ClNO3 |
|---|---|
| Molecular weight | 303.74 g/mol |
| IUPAC name | (E)-N-(3-chlorophenyl)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enamide |
| InChIKey | UBNJOSSBOHRSMZ-SOFGYWHQSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)NC2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)