Products 1225058-92-3

CAS 1225058-92-3 is the registry number for 2,5-Dimethoxy-4-methylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,5-dimethoxy-4-methylbenzenesulfonyl chloride (CAS 1225058-92-3) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 2,5-dimethoxy-4-methylbenzenesulfonyl chloride. InChIKey: DQPNDYCQGCHPNI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO4S
Molecular weight250.70 g/mol
IUPAC name2,5-dimethoxy-4-methylbenzenesulfonyl chloride
InChIKeyDQPNDYCQGCHPNI-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1OC)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)