CAS 1225058-92-3 is the registry number for 2,5-Dimethoxy-4-methylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2,5-dimethoxy-4-methylbenzenesulfonyl chloride (CAS 1225058-92-3) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 2,5-dimethoxy-4-methylbenzenesulfonyl chloride. InChIKey: DQPNDYCQGCHPNI-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO4S |
|---|---|
| Molecular weight | 250.70 g/mol |
| IUPAC name | 2,5-dimethoxy-4-methylbenzenesulfonyl chloride |
| InChIKey | DQPNDYCQGCHPNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)