Products 90220-74-9

CAS 90220-74-9 appears in our catalog under these names: 2-(4-Methoxyphenoxy)ethane-1-sulfonyl chloride, 95%, 2-(4-Methoxyphenoxy)ethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

2-(4-methoxyphenoxy)ethanesulfonyl chloride (CAS 90220-74-9) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 2-(4-methoxyphenoxy)ethanesulfonyl chloride. InChIKey: HESVPAQVZZIIBY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO4S
Molecular weight250.70 g/mol
IUPAC name2-(4-methoxyphenoxy)ethanesulfonyl chloride
InChIKeyHESVPAQVZZIIBY-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)OCCS(=O)(=O)Cl

Computed by PubChem (NCBI)