Products 1365957-71-6

CAS 1365957-71-6 appears in our catalog under these names: 2-(2-Methoxyethoxy)benzene-1-sulfonyl chloride, 95%, 2-(2-Methoxyethoxy)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(2-methoxyethoxy)benzenesulfonyl chloride (CAS 1365957-71-6) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 2-(2-methoxyethoxy)benzenesulfonyl chloride. InChIKey: VMMRLRFODPRYFN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO4S
Molecular weight250.70 g/mol
IUPAC name2-(2-methoxyethoxy)benzenesulfonyl chloride
InChIKeyVMMRLRFODPRYFN-UHFFFAOYSA-N
SMILESCOCCOC1=CC=CC=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)