CAS 60987-20-4 appears in our catalog under these names: 4,5-Dimethoxy-2-methylbenzene-1-sulfonyl chloride, 95%, 4,5-Dimethoxy-2-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4,5-dimethoxy-2-methylbenzenesulfonyl chloride (CAS 60987-20-4) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 4,5-dimethoxy-2-methylbenzenesulfonyl chloride. InChIKey: IRHPZJPWXHAKBI-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO4S |
|---|---|
| Molecular weight | 250.70 g/mol |
| IUPAC name | 4,5-dimethoxy-2-methylbenzenesulfonyl chloride |
| InChIKey | IRHPZJPWXHAKBI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)OC)OC |
Computed by PubChem (NCBI)