Products 2228548-75-0

CAS 2228548-75-0 is the registry number for 2,6-Dimethoxy-4-methylbenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,6-dimethoxy-4-methylbenzenesulfonyl chloride (CAS 2228548-75-0) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 2,6-dimethoxy-4-methylbenzenesulfonyl chloride. InChIKey: JKMMFVAMXZWVNX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO4S
Molecular weight250.70 g/mol
IUPAC name2,6-dimethoxy-4-methylbenzenesulfonyl chloride
InChIKeyJKMMFVAMXZWVNX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)OC)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)