CAS 204072-53-7 appears in our catalog under these names: 4–(2–Methoxyethoxy)benzenesulfonyl chloride, 4-(2-Methoxyethoxy)benzenesulfonyl chloride, 4-(2-Methoxyethoxy)benzenesulfonyl chloride 95%, 4-(2-Methoxyethoxy)benzenesulfonyl chloride, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
4-(2-methoxyethoxy)benzenesulfonyl chloride (CAS 204072-53-7) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 4-(2-methoxyethoxy)benzenesulfonyl chloride. InChIKey: QGHZEYHFQCDRAT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO4S |
|---|---|
| Molecular weight | 250.70 g/mol |
| IUPAC name | 4-(2-methoxyethoxy)benzenesulfonyl chloride |
| InChIKey | QGHZEYHFQCDRAT-UHFFFAOYSA-N |
| SMILES | COCCOC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)