Products 1225851-81-9
CAS 1225851-81-9 appears in our catalog under these names: 3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-amine, 95%, 3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(2-chlorophenyl)-1,2,4-oxadiazol-5-amine (CAS 1225851-81-9) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 3-(2-chlorophenyl)-1,2,4-oxadiazol-5-amine. InChIKey: WUOMNKCWSMVRLC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-1,2,4-oxadiazol-5-amine |
| InChIKey | WUOMNKCWSMVRLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)N)Cl |
Computed by PubChem (NCBI)