Products 1226070-17-2
CAS 1226070-17-2 appears in our catalog under these names: 5-Bromo-7-chloro-2-methyl-1,3-benzoxazole, 5-Bromo-7-chloro-2-methylbenzo[d]oxazole, 95%, 95%, 5-bromo-7-chloro-2-methyl-1,3-benzoxazole, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-bromo-7-chloro-2-methyl-1,3-benzoxazole (CAS 1226070-17-2) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 5-bromo-7-chloro-2-methyl-1,3-benzoxazole. InChIKey: VCZVBVOJGPFUNJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 5-bromo-7-chloro-2-methyl-1,3-benzoxazole |
| InChIKey | VCZVBVOJGPFUNJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)