Products 122645-11-8
CAS 122645-11-8 is the registry number for (S)-alpha-(((4-Ethyl-2,3-dioxo-1-piperazinyl)carbonyl)amino)benzeneacetic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetic acid (CAS 122645-11-8) is a chemical compound with the molecular formula C15H17N3O5 and a molecular weight of 319.31 g/mol. IUPAC name: (2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetic acid. InChIKey: JQEHQELQPPKXRR-NSHDSACASA-N.
| Molecular formula | C15H17N3O5 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | (2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetic acid |
| InChIKey | JQEHQELQPPKXRR-NSHDSACASA-N |
| SMILES | CCN1CCN(C(=O)C1=O)C(=O)N[C@@H](C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)