Products 179386-44-8
CAS 179386-44-8 appears in our catalog under these names: Sumanirole Maleate, (5R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (2Z)-2-butenedioate (1:1), Sumanirole (maleate), 99.78%. Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 2mg, 5mg, 25mg, 50mg, 100 mg, 50 mg.
(Z)-but-2-enedioic acid;(10R)-10-(methylamino)-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (CAS 179386-44-8) is a chemical compound with the molecular formula C15H17N3O5 and a molecular weight of 319.31 g/mol. IUPAC name: (Z)-but-2-enedioic acid;(10R)-10-(methylamino)-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one. InChIKey: VOJRMYBBPKNLLI-ORHWHDKWSA-N.
| Molecular formula | C15H17N3O5 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;(10R)-10-(methylamino)-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| InChIKey | VOJRMYBBPKNLLI-ORHWHDKWSA-N |
| SMILES | CN[C@@H]1CC2=C3C(=CC=C2)NC(=O)N3C1.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)