CAS 158693-04-0 is the registry number for Entacapone Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-2-cyano-N,N-diethyl-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enamide (CAS 158693-04-0) is a chemical compound with the molecular formula C15H17N3O5 and a molecular weight of 319.31 g/mol. IUPAC name: (Z)-2-cyano-N,N-diethyl-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enamide. InChIKey: MAZRYCCTAIVEQP-WDZFZDKYSA-N.
| Molecular formula | C15H17N3O5 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | (Z)-2-cyano-N,N-diethyl-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enamide |
| InChIKey | MAZRYCCTAIVEQP-WDZFZDKYSA-N |
| SMILES | CCN(CC)C(=O)/C(=C\C1=CC(=C(C(=C1)OC)O)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)