Products 2410517-85-8
CAS 2410517-85-8 is the registry number for Methyl 4-amino-1-(2-methoxy-4-(methoxycarbonyl)benzyl)-1H-pyrazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-amino-1-[(2-methoxy-4-methoxycarbonylphenyl)methyl]pyrazole-5-carboxylate (CAS 2410517-85-8) is a chemical compound with the molecular formula C15H17N3O5 and a molecular weight of 319.31 g/mol. IUPAC name: methyl 4-amino-1-[(2-methoxy-4-methoxycarbonylphenyl)methyl]pyrazole-5-carboxylate. InChIKey: RUFKGUMZPMJTTR-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O5 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | methyl 4-amino-1-[(2-methoxy-4-methoxycarbonylphenyl)methyl]pyrazole-5-carboxylate |
| InChIKey | RUFKGUMZPMJTTR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)CN2C(=C(C=N2)N)C(=O)OC |
Computed by PubChem (NCBI)