Products 74885-72-6
CAS 74885-72-6 appears in our catalog under these names: 5-Carboxamidotryptamine Maleate Salt Hemiethanolate, 5-Carboxamidotryptamine maleate/ 97.77% (existing batch purity), 5–Carboxamidotryptamine maleate, 5-CARBOXAMIDOTRYPTAMINE MALEATE SALT&, 5-Carboxamidotryptamine maleate, ≥97%, ≥97%. Offered by: TRC, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 100 mg.
3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid (CAS 74885-72-6) is a chemical compound with the molecular formula C15H17N3O5 and a molecular weight of 319.31 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid. InChIKey: PZQZSWAOVAMBQM-BTJKTKAUSA-N.
| Molecular formula | C15H17N3O5 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid |
| InChIKey | PZQZSWAOVAMBQM-BTJKTKAUSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)N)C(=CN2)CCN.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Carboxamidotryptamine maleate, 5-Carboxamidotryptamine (maleate), 3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid, 5-CT Maleate, orb1704731, Tox21_500352, Alternative Names: AH-21467, 5-CT, 5-Carboxamidotryptamine maleate salt, powder, >=98% (HPLC), (2Z)-But-2-enedioic acid--3-(2-aminoethyl)-1H-indole-5-carboxamide (1/1)