Products 146698-91-1
CAS 146698-91-1 appears in our catalog under these names: Entacapone Impurity 12, (E/Z)-3-O-Methyl Entacapone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(Z)-2-cyano-N,N-diethyl-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enamide (CAS 146698-91-1) is a chemical compound with the molecular formula C15H17N3O5 and a molecular weight of 319.31 g/mol. IUPAC name: (Z)-2-cyano-N,N-diethyl-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enamide. InChIKey: MAZRYCCTAIVEQP-WDZFZDKYSA-N.
| Molecular formula | C15H17N3O5 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | (Z)-2-cyano-N,N-diethyl-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enamide |
| InChIKey | MAZRYCCTAIVEQP-WDZFZDKYSA-N |
| SMILES | CCN(CC)C(=O)/C(=C\C1=CC(=C(C(=C1)OC)O)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)