Products 1226890-59-0
CAS 1226890-59-0 is the registry number for 4-Chloro-3-(trifluoromethyl)picolinic acid, 95+%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-3-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1226890-59-0) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: KFGWARZYCZTLGG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | KFGWARZYCZTLGG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)